C24H31NO4 — CID 140943047
methyl 2-(cyclopenten-1-yl)-5-ethyl-6-[ethyl(oxan-4-yl)amino]-1-benzofuran-4-carboxylate (PubChem CID 140943047) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is methyl 2-(cyclopenten-1-yl)-5-ethyl-6-[ethyl(oxan-4-yl)amino]-1-benzofuran-4-carboxylate.
| Compound Name | methyl 2-(cyclopenten-1-yl)-5-ethyl-6-[ethyl(oxan-4-yl)amino]-1-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 140943047 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | methyl 2-(cyclopenten-1-yl)-5-ethyl-6-[ethyl(oxan-4-yl)amino]-1-benzofuran-4-carboxylate |
| SMILES | CCc1c(N(CC)C2CCOCC2)cc2oc(C3=CCCC3)cc2c1C(=O)OC |
| InChI | InChI=1S/C24H31NO4/c1-4-18-20(25(5-2)17-10-12-28-13-11-17)15-22-19(23(18)24(26)27-3)14-21(29-22)16-8-6-7-9-16/h8,14-15,17H,4-7,9-13H2,1-3H3 |
| InChIKey | CAKSPDBQRNQRLO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |