C29H44N2O6 — CID 161344273
tert-butyl formate;methyl 5-ethyl-6-[ethyl(oxan-4-yl)amino]-2-piperidin-4-yl-1-benzofuran-4-carboxylate (PubChem CID 161344273) has the molecular formula C29H44N2O6 and a molecular weight of 516.68 g/mol. Its IUPAC name is tert-butyl formate;methyl 5-ethyl-6-[ethyl(oxan-4-yl)amino]-2-piperidin-4-yl-1-benzofuran-4-carboxylate.
| Compound Name | tert-butyl formate;methyl 5-ethyl-6-[ethyl(oxan-4-yl)amino]-2-piperidin-4-yl-1-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 161344273 |
| Molecular Formula | C29H44N2O6 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | tert-butyl formate;methyl 5-ethyl-6-[ethyl(oxan-4-yl)amino]-2-piperidin-4-yl-1-benzofuran-4-carboxylate |
| SMILES | CC(C)(C)OC=O.CCc1c(N(CC)C2CCOCC2)cc2oc(C3CCNCC3)cc2c1C(=O)OC |
| InChI | InChI=1S/C24H34N2O4.C5H10O2/c1-4-18-20(26(5-2)17-8-12-29-13-9-17)15-22-19(23(18)24(27)28-3)14-21(30-22)16-6-10-25-11-7-16;1-5(2,3)7-4-6/h14-17,25H,4-13H2,1-3H3;4H,1-3H3 |
| InChIKey | VNBZAGDBEKSHFS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|