C57H37N3OSSi — CID 140946225
[3-[9-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]phenyl]-triphenylsilane (PubChem CID 140946225) has the molecular formula C57H37N3OSSi and a molecular weight of 840.10 g/mol. Its IUPAC name is [3-[9-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]phenyl]-triphenylsilane.
| Compound Name | [3-[9-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 140946225 |
| Molecular Formula | C57H37N3OSSi |
| Molecular Weight | 840.10 g/mol |
| Exact Mass | 839.24 |
| IUPAC Name | [3-[9-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]phenyl]-triphenylsilane |
| SMILES | c1ccc(-c2nc(-c3ccc4sc5ccccc5c4c3)nc(-c3cccc4oc5ccc(-c6cccc([Si](c7ccccc7)(c7ccccc7)c7ccccc7)c6)cc5c34)n2)cc1 |
| InChI | InChI=1S/C57H37N3OSSi/c1-5-17-38(18-6-1)55-58-56(41-32-34-53-48(37-41)46-27-13-14-30-52(46)62-53)60-57(59-55)47-28-16-29-51-54(47)49-36-40(31-33-50(49)61-51)39-19-15-26-45(35-39)63(42-20-7-2-8-21-42,43-22-9-3-10-23-43)44-24-11-4-12-25-44/h1-37H |
| InChIKey | MCEZQTLLGPMMOY-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.10 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|