C51H37N3 — CID 140947900
5-[3-(2,3,5,6-tetraphenylphenyl)phenyl]-4,7-bis(trideuteriomethyl)benzimidazolo[1,2-a]benzimidazole (PubChem CID 140947900) has the molecular formula C51H37N3 and a molecular weight of 697.91 g/mol. Its IUPAC name is 5-[3-(2,3,5,6-tetraphenylphenyl)phenyl]-4,7-bis(trideuteriomethyl)benzimidazolo[1,2-a]benzimidazole.
| Compound Name | 5-[3-(2,3,5,6-tetraphenylphenyl)phenyl]-4,7-bis(trideuteriomethyl)benzimidazolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 140947900 |
| Molecular Formula | C51H37N3 |
| Molecular Weight | 697.91 g/mol |
| Exact Mass | 697.34 |
| IUPAC Name | 5-[3-(2,3,5,6-tetraphenylphenyl)phenyl]-4,7-bis(trideuteriomethyl)benzimidazolo[1,2-a]benzimidazole |
| SMILES | [2H]C([2H])([2H])c1cccc2c1nc1n(-c3cccc(-c4c(-c5ccccc5)c(-c5ccccc5)cc(-c5ccccc5)c4-c4ccccc4)c3)c3c(C([2H])([2H])[2H])cccc3n21 |
| InChI | InChI=1S/C51H37N3/c1-34-18-15-30-44-49(34)52-51-53(50-35(2)19-16-31-45(50)54(44)51)41-29-17-28-40(32-41)48-46(38-24-11-5-12-25-38)42(36-20-7-3-8-21-36)33-43(37-22-9-4-10-23-37)47(48)39-26-13-6-14-27-39/h3-33H,1-2H3/i1D3,2D3 |
| InChIKey | AFAJFRSQYNYQFQ-WFGJKAKNSA-N |
| XLogP | 13.38 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.91 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |