C38H25N3 — CID 137364519
6-tetraphenylen-2-yl-4-(trideuteriomethyl)benzimidazolo[1,2-a]benzimidazole (PubChem CID 137364519) has the molecular formula C38H25N3 and a molecular weight of 526.66 g/mol. Its IUPAC name is 6-tetraphenylen-2-yl-4-(trideuteriomethyl)benzimidazolo[1,2-a]benzimidazole.
| Compound Name | 6-tetraphenylen-2-yl-4-(trideuteriomethyl)benzimidazolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 137364519 |
| Molecular Formula | C38H25N3 |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 6-tetraphenylen-2-yl-4-(trideuteriomethyl)benzimidazolo[1,2-a]benzimidazole |
| SMILES | [2H]C([2H])([2H])c1cccc2c1nc1n(-c3ccc4c(c3)-c3ccccc3-c3ccccc3-c3ccccc3-4)c3ccccc3n21 |
| InChI | InChI=1S/C38H25N3/c1-24-11-10-20-36-37(24)39-38-40(34-18-8-9-19-35(34)41(36)38)25-21-22-32-30-16-5-4-14-28(30)26-12-2-3-13-27(26)29-15-6-7-17-31(29)33(32)23-25/h2-23H,1H3/b28-26-,29-27-,32-30-,33-31-/i1D3 |
| InChIKey | WAJRXGVGSGEOET-FPLBAYRRSA-N |
| XLogP | 9.72 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |