C47H37N3OSi — CID 168793001
[9,9-bis(trideuteriomethyl)xanthen-4-yl]-diphenyl-[4-[4-(trideuteriomethyl)benzimidazolo[1,2-a]benzimidazol-6-yl]phenyl]silane (PubChem CID 168793001) has the molecular formula C47H37N3OSi and a molecular weight of 696.97 g/mol. Its IUPAC name is [9,9-bis(trideuteriomethyl)xanthen-4-yl]-diphenyl-[4-[4-(trideuteriomethyl)benzimidazolo[1,2-a]benzimidazol-6-yl]phenyl]silane.
| Compound Name | [9,9-bis(trideuteriomethyl)xanthen-4-yl]-diphenyl-[4-[4-(trideuteriomethyl)benzimidazolo[1,2-a]benzimidazol-6-yl]phenyl]silane |
|---|---|
| PubChem CID | 168793001 |
| Molecular Formula | C47H37N3OSi |
| Molecular Weight | 696.97 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | [9,9-bis(trideuteriomethyl)xanthen-4-yl]-diphenyl-[4-[4-(trideuteriomethyl)benzimidazolo[1,2-a]benzimidazol-6-yl]phenyl]silane |
| SMILES | [2H]C([2H])([2H])c1cccc2c1nc1n(-c3ccc([Si](c4ccccc4)(c4ccccc4)c4cccc5c4Oc4ccccc4C5(C([2H])([2H])[2H])C([2H])([2H])[2H])cc3)c3ccccc3n21 |
| InChI | InChI=1S/C47H37N3OSi/c1-32-16-14-25-41-44(32)48-46-49(39-23-11-12-24-40(39)50(41)46)33-28-30-36(31-29-33)52(34-17-6-4-7-18-34,35-19-8-5-9-20-35)43-27-15-22-38-45(43)51-42-26-13-10-21-37(42)47(38,2)3/h4-31H,1-3H3/i1D3,2D3,3D3 |
| InChIKey | JSWIQKDMWSPFPO-GQALSZNTSA-N |
| XLogP | 8.55 |
| TPSA | 31.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.97 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|