C50H43N3OSi3 — CID 174068644
CID 174068644 (PubChem CID 174068644) has the molecular formula C50H43N3OSi3 and a molecular weight of 786.17 g/mol.
| Compound Name | CID 174068644 |
|---|---|
| PubChem CID | 174068644 |
| Molecular Formula | C50H43N3OSi3 |
| Molecular Weight | 786.17 g/mol |
| Exact Mass | 785.27 |
| IUPAC Name | — |
| SMILES | CCC[Si]C1([Si]CCC)c2ccccc2Oc2c1cccc2[Si](c1ccccc1)(c1ccccc1)c1cccc(-n2c3ccccc3n3c4ccccc4nc23)c1 |
| InChI | InChI=1S/C50H43N3OSi3/c1-3-33-55-50(56-34-4-2)40-25-11-16-31-46(40)54-48-41(50)26-18-32-47(48)57(37-20-7-5-8-21-37,38-22-9-6-10-23-38)39-24-17-19-36(35-39)52-44-29-14-15-30-45(44)53-43-28-13-12-27-42(43)51-49(52)53/h5-32,35H,3-4,33-34H2,1-2H3 |
| InChIKey | DHENJZWRXSKFNG-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 31.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.17 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|