C49H47N3OSi4 — CID 168793011
[3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[10,10-bis[tris(trideuteriomethyl)silyl]benzo[b][1,4]benzoxasilin-4-yl]-diphenylsilane (PubChem CID 168793011) has the molecular formula C49H47N3OSi4 and a molecular weight of 824.39 g/mol. Its IUPAC name is [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[10,10-bis[tris(trideuteriomethyl)silyl]benzo[b][1,4]benzoxasilin-4-yl]-diphenylsilane.
| Compound Name | [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[10,10-bis[tris(trideuteriomethyl)silyl]benzo[b][1,4]benzoxasilin-4-yl]-diphenylsilane |
|---|---|
| PubChem CID | 168793011 |
| Molecular Formula | C49H47N3OSi4 |
| Molecular Weight | 824.39 g/mol |
| Exact Mass | 823.39 |
| IUPAC Name | [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[10,10-bis[tris(trideuteriomethyl)silyl]benzo[b][1,4]benzoxasilin-4-yl]-diphenylsilane |
| SMILES | [2H]C([2H])([2H])[Si](C([2H])([2H])[2H])(C([2H])([2H])[2H])[Si]1([Si](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c2ccccc2Oc2c([Si](c3ccccc3)(c3ccccc3)c3cccc(-n4c5ccccc5n5c6ccccc6nc45)c3)cccc21 |
| InChI | InChI=1S/C49H47N3OSi4/c1-54(2,3)57(55(4,5)6)45-32-18-17-31-44(45)53-48-46(33-20-34-47(48)57)56(37-22-9-7-10-23-37,38-24-11-8-12-25-38)39-26-19-21-36(35-39)51-42-29-15-16-30-43(42)52-41-28-14-13-27-40(41)50-49(51)52/h7-35H,1-6H3/i1D3,2D3,3D3,4D3,5D3,6D3 |
| InChIKey | NDBBSOUOQHCRAZ-NBDUPMGQSA-N |
| XLogP | 8.31 |
| TPSA | 31.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.39 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|