C52H39N7OSi — CID 168793053
[3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[9,9-bis[dideuterio(pyrazol-1-yl)methyl]xanthen-4-yl]-diphenylsilane (PubChem CID 168793053) has the molecular formula C52H39N7OSi and a molecular weight of 810.04 g/mol. Its IUPAC name is [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[9,9-bis[dideuterio(pyrazol-1-yl)methyl]xanthen-4-yl]-diphenylsilane.
| Compound Name | [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[9,9-bis[dideuterio(pyrazol-1-yl)methyl]xanthen-4-yl]-diphenylsilane |
|---|---|
| PubChem CID | 168793053 |
| Molecular Formula | C52H39N7OSi |
| Molecular Weight | 810.04 g/mol |
| Exact Mass | 809.32 |
| IUPAC Name | [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[9,9-bis[dideuterio(pyrazol-1-yl)methyl]xanthen-4-yl]-diphenylsilane |
| SMILES | [2H]C([2H])(n1cccn1)C1(C([2H])([2H])n2cccn2)c2ccccc2Oc2c1cccc2[Si](c1ccccc1)(c1ccccc1)c1cccc(-n2c3ccccc3n3c4ccccc4nc23)c1 |
| InChI | InChI=1S/C52H39N7OSi/c1-3-18-39(19-4-1)61(40-20-5-2-6-21-40,41-22-13-17-38(35-41)58-46-27-10-11-28-47(46)59-45-26-9-8-25-44(45)55-51(58)59)49-30-14-24-43-50(49)60-48-29-12-7-23-42(48)52(43,36-56-33-15-31-53-56)37-57-34-16-32-54-57/h1-35H,36-37H2/i36D2,37D2 |
| InChIKey | BOXVUKQNIIKVEU-YBDXGLOESA-N |
| XLogP | 7.99 |
| TPSA | 67.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.04 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|