About CID 174068643
CID 174068643 (PubChem CID 174068643) has the molecular formula C48H39N3OSi3
and a molecular weight of 758.12 g/mol.
Molecular Properties
| Compound Name | CID 174068643 |
| PubChem CID | 174068643 |
| Molecular Formula | C48H39N3OSi3 |
| Molecular Weight | 758.12 g/mol |
| Exact Mass | 757.24 |
| IUPAC Name | — |
| SMILES | CC[Si]C1([Si]CC)c2ccccc2Oc2c1cccc2[Si](c1ccccc1)(c1ccccc1)c1cccc(-n2c3ccccc3n3c4ccccc4nc23)c1 |
| InChI | InChI=1S/C48H39N3OSi3/c1-3-53-48(54-4-2)38-25-11-16-31-44(38)52-46-39(48)26-18-32-45(46)55(35-20-7-5-8-21-35,36-22-9-6-10-23-36)37-24-17-19-34(33-37)50-42-29-14-15-30-43(42)51-41-28-13-12-27-40(41)49-47(50)51/h5-33H,3-4H2,1-2H3 |
| InChIKey | SJYJZFVHRBEAMW-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 31.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 758.12 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 174068643 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174068643?
The IUPAC name of CID 174068643 (CID 174068643) is not available.
What is the SMILES notation for CID 174068643?
The canonical SMILES for CID 174068643 is CC[Si]C1([Si]CC)c2ccccc2Oc2c1cccc2[Si](c1ccccc1)(c1ccccc1)c1cccc(-n2c3ccccc3n3c4ccccc4nc23)c1.
What is the InChIKey of CID 174068643?
The InChIKey is SJYJZFVHRBEAMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H39N3OSi3/c1-3-53-48(54-4-2)38-25-11-16-31-44(38)52-46-39(48)26-18-32-45(46)55(35-20-7-5-8-21-35,36-22-9-6-10-23-36)37-24-17-19-34(33-37)50-42-29-14-15-30-43(42)51-41-28-13-12-27-40(41)49-47(50)51/h5-33H,3-4H2,1-2H3.
What are the key properties of CID 174068643?
CID 174068643 has a molecular weight of 758.12 g/mol, XLogP of 8.40, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174068643 is sourced from PubChem (CID 174068643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).