C48H39N3OSi3 — CID 174068643
CID 174068643 (PubChem CID 174068643) has the molecular formula C48H39N3OSi3 and a molecular weight of 758.12 g/mol.
| Compound Name | CID 174068643 |
|---|---|
| PubChem CID | 174068643 |
| Molecular Formula | C48H39N3OSi3 |
| Molecular Weight | 758.12 g/mol |
| Exact Mass | 757.24 |
| IUPAC Name | — |
| SMILES | CC[Si]C1([Si]CC)c2ccccc2Oc2c1cccc2[Si](c1ccccc1)(c1ccccc1)c1cccc(-n2c3ccccc3n3c4ccccc4nc23)c1 |
| InChI | InChI=1S/C48H39N3OSi3/c1-3-53-48(54-4-2)38-25-11-16-31-44(38)52-46-39(48)26-18-32-45(46)55(35-20-7-5-8-21-35,36-22-9-6-10-23-36)37-24-17-19-34(33-37)50-42-29-14-15-30-43(42)51-41-28-13-12-27-40(41)49-47(50)51/h5-33H,3-4H2,1-2H3 |
| InChIKey | SJYJZFVHRBEAMW-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 31.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.12 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|