C54H45N5OS2Si3 — CID 167413434
[3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[9,9-bis[1,3-thiazol-2-yl-bis(trideuteriomethyl)silyl]xanthen-4-yl]-diphenylsilane (PubChem CID 167413434) has the molecular formula C54H45N5OS2Si3 and a molecular weight of 940.45 g/mol. Its IUPAC name is [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[9,9-bis[1,3-thiazol-2-yl-bis(trideuteriomethyl)silyl]xanthen-4-yl]-diphenylsilane.
| Compound Name | [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[9,9-bis[1,3-thiazol-2-yl-bis(trideuteriomethyl)silyl]xanthen-4-yl]-diphenylsilane |
|---|---|
| PubChem CID | 167413434 |
| Molecular Formula | C54H45N5OS2Si3 |
| Molecular Weight | 940.45 g/mol |
| Exact Mass | 939.31 |
| IUPAC Name | [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[9,9-bis[1,3-thiazol-2-yl-bis(trideuteriomethyl)silyl]xanthen-4-yl]-diphenylsilane |
| SMILES | [2H]C([2H])([2H])[Si](c1nccs1)(C([2H])([2H])[2H])C1([Si](c2nccs2)(C([2H])([2H])[2H])C([2H])([2H])[2H])c2ccccc2Oc2c1cccc2[Si](c1ccccc1)(c1ccccc1)c1cccc(-n2c3ccccc3n3c4ccccc4nc23)c1 |
| InChI | InChI=1S/C54H45N5OS2Si3/c1-63(2,52-55-33-35-61-52)54(64(3,4)53-56-34-36-62-53)42-25-11-16-31-48(42)60-50-43(54)26-18-32-49(50)65(39-20-7-5-8-21-39,40-22-9-6-10-23-40)41-24-17-19-38(37-41)58-46-29-14-15-30-47(46)59-45-28-13-12-27-44(45)57-51(58)59/h5-37H,1-4H3/i1D3,2D3,3D3,4D3 |
| InChIKey | VVZXQQSIRLKYMN-MGKWXGLJSA-N |
| XLogP | 9.42 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.45 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|