C45H34N4OSi — CID 168793112
[2-(benzimidazolo[1,2-a]benzimidazol-5-yl)-4-pyridinyl]-[9,9-bis(trideuteriomethyl)xanthen-4-yl]-diphenylsilane (PubChem CID 168793112) has the molecular formula C45H34N4OSi and a molecular weight of 680.92 g/mol. Its IUPAC name is [2-(benzimidazolo[1,2-a]benzimidazol-5-yl)-4-pyridinyl]-[9,9-bis(trideuteriomethyl)xanthen-4-yl]-diphenylsilane.
| Compound Name | [2-(benzimidazolo[1,2-a]benzimidazol-5-yl)-4-pyridinyl]-[9,9-bis(trideuteriomethyl)xanthen-4-yl]-diphenylsilane |
|---|---|
| PubChem CID | 168793112 |
| Molecular Formula | C45H34N4OSi |
| Molecular Weight | 680.92 g/mol |
| Exact Mass | 680.29 |
| IUPAC Name | [2-(benzimidazolo[1,2-a]benzimidazol-5-yl)-4-pyridinyl]-[9,9-bis(trideuteriomethyl)xanthen-4-yl]-diphenylsilane |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])c2ccccc2Oc2c1cccc2[Si](c1ccccc1)(c1ccccc1)c1ccnc(-n2c3ccccc3n3c4ccccc4nc23)c1 |
| InChI | InChI=1S/C45H34N4OSi/c1-45(2)34-20-9-14-26-40(34)50-43-35(45)21-15-27-41(43)51(31-16-5-3-6-17-31,32-18-7-4-8-19-32)33-28-29-46-42(30-33)49-39-25-13-12-24-38(39)48-37-23-11-10-22-36(37)47-44(48)49/h3-30H,1-2H3/i1D3,2D3 |
| InChIKey | AKPLWUCUUBNHLL-WFGJKAKNSA-N |
| XLogP | 7.64 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.92 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|