C47H40N4SSi2 — CID 140937518
[2-(benzimidazolo[1,2-a]benzimidazol-5-yl)-4-pyridinyl]-diphenyl-(5,5,6,6-tetramethylbenzo[b][1,5]benzothiasilepin-10-yl)silane (PubChem CID 140937518) has the molecular formula C47H40N4SSi2 and a molecular weight of 749.10 g/mol. Its IUPAC name is [2-(benzimidazolo[1,2-a]benzimidazol-5-yl)-4-pyridinyl]-diphenyl-(5,5,6,6-tetramethylbenzo[b][1,5]benzothiasilepin-10-yl)silane.
| Compound Name | [2-(benzimidazolo[1,2-a]benzimidazol-5-yl)-4-pyridinyl]-diphenyl-(5,5,6,6-tetramethylbenzo[b][1,5]benzothiasilepin-10-yl)silane |
|---|---|
| PubChem CID | 140937518 |
| Molecular Formula | C47H40N4SSi2 |
| Molecular Weight | 749.10 g/mol |
| Exact Mass | 748.25 |
| IUPAC Name | [2-(benzimidazolo[1,2-a]benzimidazol-5-yl)-4-pyridinyl]-diphenyl-(5,5,6,6-tetramethylbenzo[b][1,5]benzothiasilepin-10-yl)silane |
| SMILES | CC1(C)c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccnc(-n4c5ccccc5n5c6ccccc6nc45)c3)c2Sc2ccccc2[Si]1(C)C |
| InChI | InChI=1S/C47H40N4SSi2/c1-47(2)36-22-17-29-43(45(36)52-41-27-15-16-28-42(41)53(47,3)4)54(33-18-7-5-8-19-33,34-20-9-6-10-21-34)35-30-31-48-44(32-35)51-40-26-14-13-25-39(40)50-38-24-12-11-23-37(38)49-46(50)51/h5-32H,1-4H3 |
| InChIKey | OEGVEUPOZNSSGG-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.10 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|