C43H33N5SSi2 — CID 162045973
[2-(benzimidazolo[1,2-a]benzimidazol-5-yl)pyrimidin-4-yl]-[10-methyl-10-(trideuteriomethyl)benzo[b][1,4]benzothiasilin-4-yl]-diphenylsilane (PubChem CID 162045973) has the molecular formula C43H33N5SSi2 and a molecular weight of 711.03 g/mol. Its IUPAC name is [2-(benzimidazolo[1,2-a]benzimidazol-5-yl)pyrimidin-4-yl]-[10-methyl-10-(trideuteriomethyl)benzo[b][1,4]benzothiasilin-4-yl]-diphenylsilane.
| Compound Name | [2-(benzimidazolo[1,2-a]benzimidazol-5-yl)pyrimidin-4-yl]-[10-methyl-10-(trideuteriomethyl)benzo[b][1,4]benzothiasilin-4-yl]-diphenylsilane |
|---|---|
| PubChem CID | 162045973 |
| Molecular Formula | C43H33N5SSi2 |
| Molecular Weight | 711.03 g/mol |
| Exact Mass | 710.22 |
| IUPAC Name | [2-(benzimidazolo[1,2-a]benzimidazol-5-yl)pyrimidin-4-yl]-[10-methyl-10-(trideuteriomethyl)benzo[b][1,4]benzothiasilin-4-yl]-diphenylsilane |
| SMILES | [2H]C([2H])([2H])[Si]1(C)c2ccccc2Sc2c([Si](c3ccccc3)(c3ccccc3)c3ccnc(-n4c5ccccc5n5c6ccccc6nc45)n3)cccc21 |
| InChI | InChI=1S/C43H33N5SSi2/c1-50(2)37-25-14-13-24-36(37)49-41-38(50)26-15-27-39(41)51(30-16-5-3-6-17-30,31-18-7-4-8-19-31)40-28-29-44-42(46-40)48-35-23-12-11-22-34(35)47-33-21-10-9-20-32(33)45-43(47)48/h3-29H,1-2H3/i1D3 |
| InChIKey | SZUDHDPJPLIOLD-FIBGUPNXSA-N |
| XLogP | 5.89 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.03 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|