C43H33N5OSi2 — CID 140919996
[2-(benzimidazolo[1,2-a]benzimidazol-5-yl)pyrimidin-4-yl]-(10,10-dimethylbenzo[b][1,4]benzoxasilin-4-yl)-diphenylsilane (PubChem CID 140919996) has the molecular formula C43H33N5OSi2 and a molecular weight of 691.94 g/mol. Its IUPAC name is [2-(benzimidazolo[1,2-a]benzimidazol-5-yl)pyrimidin-4-yl]-(10,10-dimethylbenzo[b][1,4]benzoxasilin-4-yl)-diphenylsilane.
| Compound Name | [2-(benzimidazolo[1,2-a]benzimidazol-5-yl)pyrimidin-4-yl]-(10,10-dimethylbenzo[b][1,4]benzoxasilin-4-yl)-diphenylsilane |
|---|---|
| PubChem CID | 140919996 |
| Molecular Formula | C43H33N5OSi2 |
| Molecular Weight | 691.94 g/mol |
| Exact Mass | 691.22 |
| IUPAC Name | [2-(benzimidazolo[1,2-a]benzimidazol-5-yl)pyrimidin-4-yl]-(10,10-dimethylbenzo[b][1,4]benzoxasilin-4-yl)-diphenylsilane |
| SMILES | C[Si]1(C)c2ccccc2Oc2c1cccc2[Si](c1ccccc1)(c1ccccc1)c1ccnc(-n2c3ccccc3n3c4ccccc4nc23)n1 |
| InChI | InChI=1S/C43H33N5OSi2/c1-50(2)37-25-14-13-24-36(37)49-41-38(50)26-15-27-39(41)51(30-16-5-3-6-17-30,31-18-7-4-8-19-31)40-28-29-44-42(46-40)48-35-23-12-11-22-34(35)47-33-21-10-9-20-32(33)45-43(47)48/h3-29H,1-2H3 |
| InChIKey | LJEIQFWHVGUVKX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.94 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|