C50H42N2S2Si — CID 140937397
[3-(benzimidazolo[2,1-b][1,3]benzothiazol-4-yl)-4-(trideuteriomethyl)phenyl]-diphenyl-(5,5,6,6-tetramethylbenzo[b][1]benzothiepin-1-yl)silane (PubChem CID 140937397) has the molecular formula C50H42N2S2Si and a molecular weight of 766.14 g/mol. Its IUPAC name is [3-(benzimidazolo[2,1-b][1,3]benzothiazol-4-yl)-4-(trideuteriomethyl)phenyl]-diphenyl-(5,5,6,6-tetramethylbenzo[b][1]benzothiepin-1-yl)silane.
| Compound Name | [3-(benzimidazolo[2,1-b][1,3]benzothiazol-4-yl)-4-(trideuteriomethyl)phenyl]-diphenyl-(5,5,6,6-tetramethylbenzo[b][1]benzothiepin-1-yl)silane |
|---|---|
| PubChem CID | 140937397 |
| Molecular Formula | C50H42N2S2Si |
| Molecular Weight | 766.14 g/mol |
| Exact Mass | 765.27 |
| IUPAC Name | [3-(benzimidazolo[2,1-b][1,3]benzothiazol-4-yl)-4-(trideuteriomethyl)phenyl]-diphenyl-(5,5,6,6-tetramethylbenzo[b][1]benzothiepin-1-yl)silane |
| SMILES | [2H]C([2H])([2H])c1ccc([Si](c2ccccc2)(c2ccccc2)c2cccc3c2Sc2ccccc2C(C)(C)C3(C)C)cc1-c1cccc2c1sc1nc3ccccc3n12 |
| InChI | InChI=1S/C50H42N2S2Si/c1-33-30-31-36(32-38(33)37-22-16-27-43-46(37)54-48-51-41-25-13-14-26-42(41)52(43)48)55(34-18-8-6-9-19-34,35-20-10-7-11-21-35)45-29-17-24-40-47(45)53-44-28-15-12-23-39(44)49(2,3)50(40,4)5/h6-32H,1-5H3/i1D3 |
| InChIKey | DXHBDNYHYOEMAW-FIBGUPNXSA-N |
| XLogP | 10.78 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.14 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|