C51H45N3OSi — CID 140937535
[3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-methyl-phenyl-[3-(5,5,6,6-tetramethylbenzo[b][1]benzoxepin-1-yl)-4-(trideuteriomethyl)phenyl]silane (PubChem CID 140937535) has the molecular formula C51H45N3OSi and a molecular weight of 747.05 g/mol. Its IUPAC name is [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-methyl-phenyl-[3-(5,5,6,6-tetramethylbenzo[b][1]benzoxepin-1-yl)-4-(trideuteriomethyl)phenyl]silane.
| Compound Name | [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-methyl-phenyl-[3-(5,5,6,6-tetramethylbenzo[b][1]benzoxepin-1-yl)-4-(trideuteriomethyl)phenyl]silane |
|---|---|
| PubChem CID | 140937535 |
| Molecular Formula | C51H45N3OSi |
| Molecular Weight | 747.05 g/mol |
| Exact Mass | 746.35 |
| IUPAC Name | [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-methyl-phenyl-[3-(5,5,6,6-tetramethylbenzo[b][1]benzoxepin-1-yl)-4-(trideuteriomethyl)phenyl]silane |
| SMILES | [2H]C([2H])([2H])c1ccc([Si](C)(c2ccccc2)c2cccc(-n3c4ccccc4n4c5ccccc5nc34)c2)cc1-c1cccc2c1Oc1ccccc1C(C)(C)C2(C)C |
| InChI | InChI=1S/C51H45N3OSi/c1-34-30-31-38(33-40(34)39-22-17-24-42-48(39)55-47-29-15-10-23-41(47)50(2,3)51(42,4)5)56(6,36-19-8-7-9-20-36)37-21-16-18-35(32-37)53-45-27-13-14-28-46(45)54-44-26-12-11-25-43(44)52-49(53)54/h7-33H,1-6H3/i1D3 |
| InChIKey | MHJLTEBVFHJCGL-FIBGUPNXSA-N |
| XLogP | 10.87 |
| TPSA | 31.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.05 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|