C51H46O2Si — CID 140831756
bis[3-(9,9-dimethylxanthen-4-yl)-4-(trideuteriomethyl)phenyl]-methyl-phenylsilane (PubChem CID 140831756) has the molecular formula C51H46O2Si and a molecular weight of 725.05 g/mol. Its IUPAC name is bis[3-(9,9-dimethylxanthen-4-yl)-4-(trideuteriomethyl)phenyl]-methyl-phenylsilane.
| Compound Name | bis[3-(9,9-dimethylxanthen-4-yl)-4-(trideuteriomethyl)phenyl]-methyl-phenylsilane |
|---|---|
| PubChem CID | 140831756 |
| Molecular Formula | C51H46O2Si |
| Molecular Weight | 725.05 g/mol |
| Exact Mass | 724.36 |
| IUPAC Name | bis[3-(9,9-dimethylxanthen-4-yl)-4-(trideuteriomethyl)phenyl]-methyl-phenylsilane |
| SMILES | [2H]C([2H])([2H])c1ccc([Si](C)(c2ccccc2)c2ccc(C([2H])([2H])[2H])c(-c3cccc4c3Oc3ccccc3C4(C)C)c2)cc1-c1cccc2c1Oc1ccccc1C2(C)C |
| InChI | InChI=1S/C51H46O2Si/c1-33-27-29-36(31-40(33)38-19-15-23-44-48(38)52-46-25-13-11-21-42(46)50(44,3)4)54(7,35-17-9-8-10-18-35)37-30-28-34(2)41(32-37)39-20-16-24-45-49(39)53-47-26-14-12-22-43(47)51(45,5)6/h8-32H,1-7H3/i1D3,2D3 |
| InChIKey | DBTSLTYIRLGRAQ-WFGJKAKNSA-N |
| XLogP | 11.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.05 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|