C58H52O2Si — CID 140831734
bis[3-[9,9-dimethyl-3,6-bis(trideuteriomethyl)xanthen-4-yl]phenyl]-diphenylsilane (PubChem CID 140831734) has the molecular formula C58H52O2Si and a molecular weight of 821.21 g/mol. Its IUPAC name is bis[3-[9,9-dimethyl-3,6-bis(trideuteriomethyl)xanthen-4-yl]phenyl]-diphenylsilane.
| Compound Name | bis[3-[9,9-dimethyl-3,6-bis(trideuteriomethyl)xanthen-4-yl]phenyl]-diphenylsilane |
|---|---|
| PubChem CID | 140831734 |
| Molecular Formula | C58H52O2Si |
| Molecular Weight | 821.21 g/mol |
| Exact Mass | 820.45 |
| IUPAC Name | bis[3-[9,9-dimethyl-3,6-bis(trideuteriomethyl)xanthen-4-yl]phenyl]-diphenylsilane |
| SMILES | [2H]C([2H])([2H])c1ccc2c(c1)Oc1c(ccc(C([2H])([2H])[2H])c1-c1cccc([Si](c3ccccc3)(c3ccccc3)c3cccc(-c4c(C([2H])([2H])[2H])ccc5c4Oc4cc(C([2H])([2H])[2H])ccc4C5(C)C)c3)c1)C2(C)C |
| InChI | InChI=1S/C58H52O2Si/c1-37-25-29-47-51(33-37)59-55-49(57(47,5)6)31-27-39(3)53(55)41-17-15-23-45(35-41)61(43-19-11-9-12-20-43,44-21-13-10-14-22-44)46-24-16-18-42(36-46)54-40(4)28-32-50-56(54)60-52-34-38(2)26-30-48(52)58(50,7)8/h9-36H,1-8H3/i1D3,2D3,3D3,4D3 |
| InChIKey | KQQIBAZYDQOGQR-MGKWXGLJSA-N |
| XLogP | 12.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.21 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|