C55H40N2O2 — CID 167413395
4-[5-tetraphenylen-2-yl-3,6,9,9-tetrakis(trideuteriomethyl)xanthen-2-yl]-3-(trideuteriomethyl)benzimidazolo[2,1-b][1,3]benzoxazole (PubChem CID 167413395) has the molecular formula C55H40N2O2 and a molecular weight of 776.03 g/mol. Its IUPAC name is 4-[5-tetraphenylen-2-yl-3,6,9,9-tetrakis(trideuteriomethyl)xanthen-2-yl]-3-(trideuteriomethyl)benzimidazolo[2,1-b][1,3]benzoxazole.
| Compound Name | 4-[5-tetraphenylen-2-yl-3,6,9,9-tetrakis(trideuteriomethyl)xanthen-2-yl]-3-(trideuteriomethyl)benzimidazolo[2,1-b][1,3]benzoxazole |
|---|---|
| PubChem CID | 167413395 |
| Molecular Formula | C55H40N2O2 |
| Molecular Weight | 776.03 g/mol |
| Exact Mass | 775.40 |
| IUPAC Name | 4-[5-tetraphenylen-2-yl-3,6,9,9-tetrakis(trideuteriomethyl)xanthen-2-yl]-3-(trideuteriomethyl)benzimidazolo[2,1-b][1,3]benzoxazole |
| SMILES | [2H]C([2H])([2H])c1cc2c(cc1-c1c(C([2H])([2H])[2H])ccc3c1oc1nc4ccccc4n13)C(C([2H])([2H])[2H])(C([2H])([2H])[2H])c1ccc(C([2H])([2H])[2H])c(-c3ccc4c(c3)-c3ccccc3-c3ccccc3-c3ccccc3-4)c1O2 |
| InChI | InChI=1S/C55H40N2O2/c1-31-22-26-44-52(50(31)34-24-25-41-39-18-9-8-16-37(39)35-14-6-7-15-36(35)38-17-10-11-19-40(38)43(41)29-34)58-49-28-33(3)42(30-45(49)55(44,4)5)51-32(2)23-27-48-53(51)59-54-56-46-20-12-13-21-47(46)57(48)54/h6-30H,1-5H3/b37-35-,38-36-,41-39-,43-40-/i1D3,2D3,3D3,4D3,5D3 |
| InChIKey | PYYMYZWDJINBIN-LGPYEHGSSA-N |
| XLogP | 14.91 |
| TPSA | 39.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.03 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |