C58H48O2 — CID 168793077
2-[3,6,9,9-tetrakis(trideuteriomethyl)xanthen-4-yl]-5-tetraphenylen-2-yl-3,6,9,9-tetrakis(trideuteriomethyl)xanthene (PubChem CID 168793077) has the molecular formula C58H48O2 and a molecular weight of 801.17 g/mol. Its IUPAC name is 2-[3,6,9,9-tetrakis(trideuteriomethyl)xanthen-4-yl]-5-tetraphenylen-2-yl-3,6,9,9-tetrakis(trideuteriomethyl)xanthene.
| Compound Name | 2-[3,6,9,9-tetrakis(trideuteriomethyl)xanthen-4-yl]-5-tetraphenylen-2-yl-3,6,9,9-tetrakis(trideuteriomethyl)xanthene |
|---|---|
| PubChem CID | 168793077 |
| Molecular Formula | C58H48O2 |
| Molecular Weight | 801.17 g/mol |
| Exact Mass | 800.52 |
| IUPAC Name | 2-[3,6,9,9-tetrakis(trideuteriomethyl)xanthen-4-yl]-5-tetraphenylen-2-yl-3,6,9,9-tetrakis(trideuteriomethyl)xanthene |
| SMILES | [2H]C([2H])([2H])c1ccc2c(c1)Oc1c(ccc(C([2H])([2H])[2H])c1-c1cc3c(cc1C([2H])([2H])[2H])Oc1c(ccc(C([2H])([2H])[2H])c1-c1ccc4c(c1)-c1ccccc1-c1ccccc1-c1ccccc1-4)C3(C([2H])([2H])[2H])C([2H])([2H])[2H])C2(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C58H48O2/c1-33-21-26-47-51(29-33)59-56-49(57(47,5)6)28-23-35(3)54(56)45-32-50-52(30-36(45)4)60-55-48(58(50,7)8)27-22-34(2)53(55)37-24-25-44-42-19-12-11-17-40(42)38-15-9-10-16-39(38)41-18-13-14-20-43(41)46(44)31-37/h9-32H,1-8H3/b40-38-,41-39-,44-42-,46-43-/i1D3,2D3,3D3,4D3,5D3,6D3,7D3,8D3 |
| InChIKey | GSAWTQZXZVDJKH-AMRBNBDVSA-N |
| XLogP | 16.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.17 |
| LogP ≤ 5 | 16.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |