C42H34S — CID 158983834
6-(1,1-dideuterioethyl)-9,9-dimethyl-2-tetraphenylen-2-yl-3-(trideuteriomethyl)thioxanthene (PubChem CID 158983834) has the molecular formula C42H34S and a molecular weight of 575.83 g/mol. Its IUPAC name is 6-(1,1-dideuterioethyl)-9,9-dimethyl-2-tetraphenylen-2-yl-3-(trideuteriomethyl)thioxanthene.
| Compound Name | 6-(1,1-dideuterioethyl)-9,9-dimethyl-2-tetraphenylen-2-yl-3-(trideuteriomethyl)thioxanthene |
|---|---|
| PubChem CID | 158983834 |
| Molecular Formula | C42H34S |
| Molecular Weight | 575.83 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | 6-(1,1-dideuterioethyl)-9,9-dimethyl-2-tetraphenylen-2-yl-3-(trideuteriomethyl)thioxanthene |
| SMILES | [2H]C([2H])([2H])c1cc2c(cc1-c1ccc3c(c1)-c1ccccc1-c1ccccc1-c1ccccc1-3)C(C)(C)c1ccc(C([2H])([2H])C)cc1S2 |
| InChI | InChI=1S/C42H34S/c1-5-27-18-21-38-41(23-27)43-40-22-26(2)36(25-39(40)42(38,3)4)28-19-20-35-33-16-9-8-14-31(33)29-12-6-7-13-30(29)32-15-10-11-17-34(32)37(35)24-28/h6-25H,5H2,1-4H3/b31-29-,32-30-,35-33-,37-34-/i2D3,5D2 |
| InChIKey | GFCRKNIYJSOZBD-WYZISAPJSA-N |
| XLogP | 12.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.83 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |