C45H42O2Si — CID 174068734
4-[4-[4-(9,9-dimethylxanthen-4-yl)-2,5-dimethylphenyl]-2,5-dimethylphenyl]-10,10-dimethylbenzo[b][1,4]benzoxasiline (PubChem CID 174068734) has the molecular formula C45H42O2Si and a molecular weight of 642.92 g/mol. Its IUPAC name is 4-[4-[4-(9,9-dimethylxanthen-4-yl)-2,5-dimethylphenyl]-2,5-dimethylphenyl]-10,10-dimethylbenzo[b][1,4]benzoxasiline.
| Compound Name | 4-[4-[4-(9,9-dimethylxanthen-4-yl)-2,5-dimethylphenyl]-2,5-dimethylphenyl]-10,10-dimethylbenzo[b][1,4]benzoxasiline |
|---|---|
| PubChem CID | 174068734 |
| Molecular Formula | C45H42O2Si |
| Molecular Weight | 642.92 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 4-[4-[4-(9,9-dimethylxanthen-4-yl)-2,5-dimethylphenyl]-2,5-dimethylphenyl]-10,10-dimethylbenzo[b][1,4]benzoxasiline |
| SMILES | Cc1cc(-c2cccc3c2Oc2ccccc2C3(C)C)c(C)cc1-c1cc(C)c(-c2cccc3c2Oc2ccccc2[Si]3(C)C)cc1C |
| InChI | InChI=1S/C45H42O2Si/c1-27-25-35(29(3)23-33(27)31-15-13-18-38-43(31)46-39-19-10-9-17-37(39)45(38,5)6)36-26-28(2)34(24-30(36)4)32-16-14-22-42-44(32)47-40-20-11-12-21-41(40)48(42,7)8/h9-26H,1-8H3 |
| InChIKey | ZRPPCVNXZVFLKV-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.92 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|