C44H46O2 — CID 134165296
4-[2,4-ditert-butyl-3-(9,9-dimethylxanthen-4-yl)phenyl]-9,9-dimethylxanthene (PubChem CID 134165296) has the molecular formula C44H46O2 and a molecular weight of 606.85 g/mol. Its IUPAC name is 4-[2,4-ditert-butyl-3-(9,9-dimethylxanthen-4-yl)phenyl]-9,9-dimethylxanthene.
| Compound Name | 4-[2,4-ditert-butyl-3-(9,9-dimethylxanthen-4-yl)phenyl]-9,9-dimethylxanthene |
|---|---|
| PubChem CID | 134165296 |
| Molecular Formula | C44H46O2 |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.35 |
| IUPAC Name | 4-[2,4-ditert-butyl-3-(9,9-dimethylxanthen-4-yl)phenyl]-9,9-dimethylxanthene |
| SMILES | CC(C)(C)c1ccc(-c2cccc3c2Oc2ccccc2C3(C)C)c(C(C)(C)C)c1-c1cccc2c1Oc1ccccc1C2(C)C |
| InChI | InChI=1S/C44H46O2/c1-41(2,3)32-26-25-27(28-17-15-21-33-39(28)45-35-23-13-11-19-30(35)43(33,7)8)38(42(4,5)6)37(32)29-18-16-22-34-40(29)46-36-24-14-12-20-31(36)44(34,9)10/h11-26H,1-10H3 |
| InChIKey | TUHNPHGSRCQNHT-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |