C55H53NO2SSi — CID 140937460
3,5-ditert-butyl-4-(10,10'-spirobi[benzo[b][1,4]benzoxasiline]-4'-yl)-2-(5,5,6,6-tetramethylbenzo[b][1]benzothiepin-1-yl)pyridine (PubChem CID 140937460) has the molecular formula C55H53NO2SSi and a molecular weight of 820.19 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-(10,10'-spirobi[benzo[b][1,4]benzoxasiline]-4'-yl)-2-(5,5,6,6-tetramethylbenzo[b][1]benzothiepin-1-yl)pyridine.
| Compound Name | 3,5-ditert-butyl-4-(10,10'-spirobi[benzo[b][1,4]benzoxasiline]-4'-yl)-2-(5,5,6,6-tetramethylbenzo[b][1]benzothiepin-1-yl)pyridine |
|---|---|
| PubChem CID | 140937460 |
| Molecular Formula | C55H53NO2SSi |
| Molecular Weight | 820.19 g/mol |
| Exact Mass | 819.36 |
| IUPAC Name | 3,5-ditert-butyl-4-(10,10'-spirobi[benzo[b][1,4]benzoxasiline]-4'-yl)-2-(5,5,6,6-tetramethylbenzo[b][1]benzothiepin-1-yl)pyridine |
| SMILES | CC(C)(C)c1cnc(-c2cccc3c2Sc2ccccc2C(C)(C)C3(C)C)c(C(C)(C)C)c1-c1cccc2c1Oc1ccccc1[Si]21c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C55H53NO2SSi/c1-52(2,3)38-33-56-49(35-22-19-24-37-51(35)59-42-28-15-11-23-36(42)54(7,8)55(37,9)10)48(53(4,5)6)47(38)34-21-20-32-46-50(34)58-41-27-14-18-31-45(41)60(46)43-29-16-12-25-39(43)57-40-26-13-17-30-44(40)60/h11-33H,1-10H3 |
| InChIKey | LFDOHRCQMKNYEK-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.19 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|