C52H48S2Si — CID 168793188
[9,9-bis(trideuteriomethyl)thioxanthen-4-yl]-[3-[9,9-bis(trideuteriomethyl)thioxanthen-4-yl]-4-tert-butylphenyl]-diphenylsilane (PubChem CID 168793188) has the molecular formula C52H48S2Si and a molecular weight of 777.25 g/mol. Its IUPAC name is [9,9-bis(trideuteriomethyl)thioxanthen-4-yl]-[3-[9,9-bis(trideuteriomethyl)thioxanthen-4-yl]-4-tert-butylphenyl]-diphenylsilane.
| Compound Name | [9,9-bis(trideuteriomethyl)thioxanthen-4-yl]-[3-[9,9-bis(trideuteriomethyl)thioxanthen-4-yl]-4-tert-butylphenyl]-diphenylsilane |
|---|---|
| PubChem CID | 168793188 |
| Molecular Formula | C52H48S2Si |
| Molecular Weight | 777.25 g/mol |
| Exact Mass | 776.37 |
| IUPAC Name | [9,9-bis(trideuteriomethyl)thioxanthen-4-yl]-[3-[9,9-bis(trideuteriomethyl)thioxanthen-4-yl]-4-tert-butylphenyl]-diphenylsilane |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])c2ccccc2Sc2c(-c3cc([Si](c4ccccc4)(c4ccccc4)c4cccc5c4Sc4ccccc4C5(C([2H])([2H])[2H])C([2H])([2H])[2H])ccc3C(C)(C)C)cccc21 |
| InChI | InChI=1S/C52H48S2Si/c1-50(2,3)40-33-32-37(34-39(40)38-24-18-27-43-48(38)53-45-29-16-14-25-41(45)51(43,4)5)55(35-20-10-8-11-21-35,36-22-12-9-13-23-36)47-31-19-28-44-49(47)54-46-30-17-15-26-42(46)52(44,6)7/h8-34H,1-7H3/i4D3,5D3,6D3,7D3 |
| InChIKey | WBNFRXQZOQJIRJ-MSOQIZQKSA-N |
| XLogP | 11.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.25 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|