C53H39N5OSSi — CID 162065529
[3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[9-[dideuterio(1,3-thiazol-4-yl)methyl]-9-(3H-pyrrol-5-ylmethyl)xanthen-4-yl]-diphenylsilane (PubChem CID 162065529) has the molecular formula C53H39N5OSSi and a molecular weight of 824.09 g/mol. Its IUPAC name is [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[9-[dideuterio(1,3-thiazol-4-yl)methyl]-9-(3H-pyrrol-5-ylmethyl)xanthen-4-yl]-diphenylsilane.
| Compound Name | [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[9-[dideuterio(1,3-thiazol-4-yl)methyl]-9-(3H-pyrrol-5-ylmethyl)xanthen-4-yl]-diphenylsilane |
|---|---|
| PubChem CID | 162065529 |
| Molecular Formula | C53H39N5OSSi |
| Molecular Weight | 824.09 g/mol |
| Exact Mass | 823.28 |
| IUPAC Name | [3-(benzimidazolo[1,2-a]benzimidazol-5-yl)phenyl]-[9-[dideuterio(1,3-thiazol-4-yl)methyl]-9-(3H-pyrrol-5-ylmethyl)xanthen-4-yl]-diphenylsilane |
| SMILES | [2H]C([2H])(c1cscn1)C1(CC2=CCC=N2)c2ccccc2Oc2c1cccc2[Si](c1ccccc1)(c1ccccc1)c1cccc(-n2c3ccccc3n3c4ccccc4nc23)c1 |
| InChI | InChI=1S/C53H39N5OSSi/c1-3-18-40(19-4-1)61(41-20-5-2-6-21-41,42-22-13-17-39(32-42)57-47-27-10-11-28-48(47)58-46-26-9-8-25-45(46)56-52(57)58)50-30-14-24-44-51(50)59-49-29-12-7-23-43(49)53(44,33-37-16-15-31-54-37)34-38-35-60-36-55-38/h1-14,16-32,35-36H,15,33-34H2/i34D2 |
| InChIKey | GGVNKMNSZFOZGV-IDMOMOHXSA-N |
| XLogP | 9.65 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.09 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|