C25H12F7O2S+ — CID 140957000
10-[2,6-difluoro-4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenyl]phenoxathiin-10-ium (PubChem CID 140957000) has the molecular formula C25H12F7O2S+ and a molecular weight of 509.42 g/mol. Its IUPAC name is 10-[2,6-difluoro-4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenyl]phenoxathiin-10-ium.
| Compound Name | 10-[2,6-difluoro-4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenyl]phenoxathiin-10-ium |
|---|---|
| PubChem CID | 140957000 |
| Molecular Formula | C25H12F7O2S+ |
| Molecular Weight | 509.42 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | 10-[2,6-difluoro-4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenyl]phenoxathiin-10-ium |
| SMILES | Fc1cc(OCc2c(F)c(F)c(F)c(F)c2F)cc(F)c1[S+]1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C25H12F7O2S/c26-14-9-12(33-11-13-20(28)22(30)24(32)23(31)21(13)29)10-15(27)25(14)35-18-7-3-1-5-16(18)34-17-6-2-4-8-19(17)35/h1-10H,11H2/q+1 |
| InChIKey | UOFYUORICGURPU-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.42 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|