C29H26ClN5O5 — CID 140960054
(2-chlorophenyl)-[6-(3,6-dihydro-2H-pyran-4-yl)-4-[[1-[(4-methoxyphenyl)methyl]-5-methyl-4-nitropyrazol-3-yl]amino]-3-pyridinyl]methanone (PubChem CID 140960054) has the molecular formula C29H26ClN5O5 and a molecular weight of 560.01 g/mol. Its IUPAC name is (2-chlorophenyl)-[6-(3,6-dihydro-2H-pyran-4-yl)-4-[[1-[(4-methoxyphenyl)methyl]-5-methyl-4-nitropyrazol-3-yl]amino]-3-pyridinyl]methanone.
| Compound Name | (2-chlorophenyl)-[6-(3,6-dihydro-2H-pyran-4-yl)-4-[[1-[(4-methoxyphenyl)methyl]-5-methyl-4-nitropyrazol-3-yl]amino]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 140960054 |
| Molecular Formula | C29H26ClN5O5 |
| Molecular Weight | 560.01 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | (2-chlorophenyl)-[6-(3,6-dihydro-2H-pyran-4-yl)-4-[[1-[(4-methoxyphenyl)methyl]-5-methyl-4-nitropyrazol-3-yl]amino]-3-pyridinyl]methanone |
| SMILES | COc1ccc(Cn2nc(Nc3cc(C4=CCOCC4)ncc3C(=O)c3ccccc3Cl)c([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C29H26ClN5O5/c1-18-27(35(37)38)29(33-34(18)17-19-7-9-21(39-2)10-8-19)32-26-15-25(20-11-13-40-14-12-20)31-16-23(26)28(36)22-5-3-4-6-24(22)30/h3-11,15-16H,12-14,17H2,1-2H3,(H,31,32,33) |
| InChIKey | VMDITBLIRCGZFJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.01 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|