C11H7BrF2IN3O — CID 140963801
5-bromo-4-[[6-(1,1-difluoro-2-iodoethyl)-3-pyridinyl]oxy]pyrimidine (PubChem CID 140963801) has the molecular formula C11H7BrF2IN3O and a molecular weight of 442.00 g/mol. Its IUPAC name is 5-bromo-4-[[6-(1,1-difluoro-2-iodoethyl)-3-pyridinyl]oxy]pyrimidine.
| Compound Name | 5-bromo-4-[[6-(1,1-difluoro-2-iodoethyl)-3-pyridinyl]oxy]pyrimidine |
|---|---|
| PubChem CID | 140963801 |
| Molecular Formula | C11H7BrF2IN3O |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 440.88 |
| IUPAC Name | 5-bromo-4-[[6-(1,1-difluoro-2-iodoethyl)-3-pyridinyl]oxy]pyrimidine |
| SMILES | FC(F)(CI)c1ccc(Oc2ncncc2Br)cn1 |
| InChI | InChI=1S/C11H7BrF2IN3O/c12-8-4-16-6-18-10(8)19-7-1-2-9(17-3-7)11(13,14)5-15/h1-4,6H,5H2 |
| InChIKey | DGMJIMBWXZTSLV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|