C9H7F5IN — CID 167136090
2-(1,1-difluoro-2-iodoethyl)-5-(2,2,2-trifluoroethyl)pyridine (PubChem CID 167136090) has the molecular formula C9H7F5IN and a molecular weight of 351.06 g/mol. Its IUPAC name is 2-(1,1-difluoro-2-iodoethyl)-5-(2,2,2-trifluoroethyl)pyridine.
| Compound Name | 2-(1,1-difluoro-2-iodoethyl)-5-(2,2,2-trifluoroethyl)pyridine |
|---|---|
| PubChem CID | 167136090 |
| Molecular Formula | C9H7F5IN |
| Molecular Weight | 351.06 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 2-(1,1-difluoro-2-iodoethyl)-5-(2,2,2-trifluoroethyl)pyridine |
| SMILES | FC(F)(F)Cc1ccc(C(F)(F)CI)nc1 |
| InChI | InChI=1S/C9H7F5IN/c10-8(11,5-15)7-2-1-6(4-16-7)3-9(12,13)14/h1-2,4H,3,5H2 |
| InChIKey | UMSVNWBLTWPYIO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.06 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|