C14H16N2O4 — CID 14096465
6-(3,4-dimethoxyphenyl)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 14096465) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-(3,4-dimethoxyphenyl)-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14096465 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | COc1ccc(-c2cc(=O)n(C)c(=O)n2C)cc1OC |
| InChI | InChI=1S/C14H16N2O4/c1-15-10(8-13(17)16(2)14(15)18)9-5-6-11(19-3)12(7-9)20-4/h5-8H,1-4H3 |
| InChIKey | HDILJLGDCHICLC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |