C41H24N6O — CID 140966591
4-([1]benzofuro[2,3-b]indol-6-yl)-2,3,5,6-tetrapyridin-3-ylbenzonitrile (PubChem CID 140966591) has the molecular formula C41H24N6O and a molecular weight of 616.68 g/mol. Its IUPAC name is 4-([1]benzofuro[2,3-b]indol-6-yl)-2,3,5,6-tetrapyridin-3-ylbenzonitrile.
| Compound Name | 4-([1]benzofuro[2,3-b]indol-6-yl)-2,3,5,6-tetrapyridin-3-ylbenzonitrile |
|---|---|
| PubChem CID | 140966591 |
| Molecular Formula | C41H24N6O |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | 4-([1]benzofuro[2,3-b]indol-6-yl)-2,3,5,6-tetrapyridin-3-ylbenzonitrile |
| SMILES | N#Cc1c(-c2cccnc2)c(-c2cccnc2)c(-n2c3ccccc3c3c4ccccc4oc32)c(-c2cccnc2)c1-c1cccnc1 |
| InChI | InChI=1S/C41H24N6O/c42-21-32-35(26-9-5-17-43-22-26)37(28-11-7-19-45-24-28)40(38(29-12-8-20-46-25-29)36(32)27-10-6-18-44-23-27)47-33-15-3-1-13-30(33)39-31-14-2-4-16-34(31)48-41(39)47/h1-20,22-25H |
| InChIKey | HPPZNNWVFBHFCZ-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 93.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |