C15H14FNO4S — CID 140967676
2-(fluoromethyl)-4-(4-methylphenyl)-5-sulfamoylbenzoic acid (PubChem CID 140967676) has the molecular formula C15H14FNO4S and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-(fluoromethyl)-4-(4-methylphenyl)-5-sulfamoylbenzoic acid.
| Compound Name | 2-(fluoromethyl)-4-(4-methylphenyl)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 140967676 |
| Molecular Formula | C15H14FNO4S |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-(fluoromethyl)-4-(4-methylphenyl)-5-sulfamoylbenzoic acid |
| SMILES | Cc1ccc(-c2cc(CF)c(C(=O)O)cc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H14FNO4S/c1-9-2-4-10(5-3-9)12-6-11(8-16)13(15(18)19)7-14(12)22(17,20)21/h2-7H,8H2,1H3,(H,18,19)(H2,17,20,21) |
| InChIKey | QUMRCTGUTVZPLK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |