C17H26N2O3S — CID 140968454
3-hydroxy-2-piperidin-1-yl-3-[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]propanoic acid (PubChem CID 140968454) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 3-hydroxy-2-piperidin-1-yl-3-[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]propanoic acid.
| Compound Name | 3-hydroxy-2-piperidin-1-yl-3-[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 140968454 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-hydroxy-2-piperidin-1-yl-3-[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]propanoic acid |
| SMILES | O=C(O)C(C(O)c1ccc(CN2CCCC2)s1)N1CCCCC1 |
| InChI | InChI=1S/C17H26N2O3S/c20-16(15(17(21)22)19-10-2-1-3-11-19)14-7-6-13(23-14)12-18-8-4-5-9-18/h6-7,15-16,20H,1-5,8-12H2,(H,21,22) |
| InChIKey | HXYCXLBUEMCENN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |