C20H18Cl2Zr — CID 140968929
1-(2-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;dichlorozirconium (PubChem CID 140968929) has the molecular formula C20H18Cl2Zr and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-(2-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;dichlorozirconium.
| Compound Name | 1-(2-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;dichlorozirconium |
|---|---|
| PubChem CID | 140968929 |
| Molecular Formula | C20H18Cl2Zr |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 1-(2-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;dichlorozirconium |
| SMILES | C1=CCC(CCc2cccc3c2Cc2ccccc2-3)=C1.Cl[Zr]Cl |
| InChI | InChI=1S/C20H18.2ClH.Zr/c1-2-7-15(6-1)12-13-16-9-5-11-19-18-10-4-3-8-17(18)14-20(16)19;;;/h1-6,8-11H,7,12-14H2;2*1H;/q;;;+2/p-2 |
| InChIKey | RBKVCOZBGFYMSD-UHFFFAOYSA-L |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |