C9H15N5O — CID 140969377
2,6-diamino-1-piperidin-4-ylpyrimidin-4-one (PubChem CID 140969377) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 2,6-diamino-1-piperidin-4-ylpyrimidin-4-one.
| Compound Name | 2,6-diamino-1-piperidin-4-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 140969377 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2,6-diamino-1-piperidin-4-ylpyrimidin-4-one |
| SMILES | Nc1cc(=O)nc(N)n1C1CCNCC1 |
| InChI | InChI=1S/C9H15N5O/c10-7-5-8(15)13-9(11)14(7)6-1-3-12-4-2-6/h5-6,12H,1-4,10H2,(H2,11,13,15) |
| InChIKey | JPCBOIUUKBJWEY-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |