C28H55NO6 — CID 140971805
(3R,4R,5S,6R)-6-(hydroxymethyl)-3-(3-methoxypropylamino)-2-[(Z)-octadec-9-enyl]oxane-2,4,5-triol (PubChem CID 140971805) has the molecular formula C28H55NO6 and a molecular weight of 501.75 g/mol. Its IUPAC name is (3R,4R,5S,6R)-6-(hydroxymethyl)-3-(3-methoxypropylamino)-2-[(Z)-octadec-9-enyl]oxane-2,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-6-(hydroxymethyl)-3-(3-methoxypropylamino)-2-[(Z)-octadec-9-enyl]oxane-2,4,5-triol |
|---|---|
| PubChem CID | 140971805 |
| Molecular Formula | C28H55NO6 |
| Molecular Weight | 501.75 g/mol |
| Exact Mass | 501.40 |
| IUPAC Name | (3R,4R,5S,6R)-6-(hydroxymethyl)-3-(3-methoxypropylamino)-2-[(Z)-octadec-9-enyl]oxane-2,4,5-triol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC1(O)O[C@H](CO)[C@@H](O)[C@H](O)C1NCCCOC |
| InChI | InChI=1S/C28H55NO6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-28(33)27(29-21-19-22-34-2)26(32)25(31)24(23-30)35-28/h10-11,24-27,29-33H,3-9,12-23H2,1-2H3/b11-10-/t24-,25-,26+,27?,28?/m1/s1 |
| InChIKey | GJYOTVDOVCCPPX-KUWYTCJWSA-N |
| XLogP | 4.21 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.75 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|