C33H48 — CID 140972193
8-ethyl-8,9-bis(hex-1-ynyl)-9-prop-1-ynylhexadeca-6,10-diyne (PubChem CID 140972193) has the molecular formula C33H48 and a molecular weight of 444.75 g/mol. Its IUPAC name is 8-ethyl-8,9-bis(hex-1-ynyl)-9-prop-1-ynylhexadeca-6,10-diyne.
| Compound Name | 8-ethyl-8,9-bis(hex-1-ynyl)-9-prop-1-ynylhexadeca-6,10-diyne |
|---|---|
| PubChem CID | 140972193 |
| Molecular Formula | C33H48 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 444.38 |
| IUPAC Name | 8-ethyl-8,9-bis(hex-1-ynyl)-9-prop-1-ynylhexadeca-6,10-diyne |
| SMILES | CC#CC(C#CCCCC)(C#CCCCCC)C(C#CCCCC)(C#CCCCCC)CC |
| InChI | InChI=1S/C33H48/c1-7-13-17-21-25-29-32(12-6,28-23-19-15-9-3)33(27-11-5,30-24-20-16-10-4)31-26-22-18-14-8-2/h7-10,12-22H2,1-6H3 |
| InChIKey | NRMGUVXLWLZNSY-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|