C40H72O4 — CID 140973214
butyl (Z)-2-[(Z)-hexadec-7-enyl]-3,4-dioxoicos-11-enoate (PubChem CID 140973214) has the molecular formula C40H72O4 and a molecular weight of 617.01 g/mol. Its IUPAC name is butyl (Z)-2-[(Z)-hexadec-7-enyl]-3,4-dioxoicos-11-enoate.
| Compound Name | butyl (Z)-2-[(Z)-hexadec-7-enyl]-3,4-dioxoicos-11-enoate |
|---|---|
| PubChem CID | 140973214 |
| Molecular Formula | C40H72O4 |
| Molecular Weight | 617.01 g/mol |
| Exact Mass | 616.54 |
| IUPAC Name | butyl (Z)-2-[(Z)-hexadec-7-enyl]-3,4-dioxoicos-11-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCC(=O)C(=O)C(CCCCCC/C=C\CCCCCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C40H72O4/c1-4-7-10-12-14-16-18-20-22-24-26-28-30-32-34-37(40(43)44-36-9-6-3)39(42)38(41)35-33-31-29-27-25-23-21-19-17-15-13-11-8-5-2/h20-23,37H,4-19,24-36H2,1-3H3/b22-20-,23-21- |
| InChIKey | SGUQPXYUYKSKKB-YEUCEMRASA-N |
| XLogP | 12.38 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.01 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|