C6H4Cl4N6S — CID 140973279
4-[dichloro-[dichloro(2H-triazol-4-yl)methyl]sulfanylmethyl]-2H-triazole (PubChem CID 140973279) has the molecular formula C6H4Cl4N6S and a molecular weight of 334.02 g/mol. Its IUPAC name is 4-[dichloro-[dichloro(2H-triazol-4-yl)methyl]sulfanylmethyl]-2H-triazole.
| Compound Name | 4-[dichloro-[dichloro(2H-triazol-4-yl)methyl]sulfanylmethyl]-2H-triazole |
|---|---|
| PubChem CID | 140973279 |
| Molecular Formula | C6H4Cl4N6S |
| Molecular Weight | 334.02 g/mol |
| Exact Mass | 331.90 |
| IUPAC Name | 4-[dichloro-[dichloro(2H-triazol-4-yl)methyl]sulfanylmethyl]-2H-triazole |
| SMILES | ClC(Cl)(SC(Cl)(Cl)c1cn[nH]n1)c1cn[nH]n1 |
| InChI | InChI=1S/C6H4Cl4N6S/c7-5(8,3-1-11-15-13-3)17-6(9,10)4-2-12-16-14-4/h1-2H,(H,11,13,15)(H,12,14,16) |
| InChIKey | NYVSPTNVQKVJRX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.02 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|