C19H24N6O — CID 150398320
2,3,4,5-tetramethyl-6-[2-methylidene-1,1-bis(2H-triazol-4-yl)butyl]phenol (PubChem CID 150398320) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-6-[2-methylidene-1,1-bis(2H-triazol-4-yl)butyl]phenol.
| Compound Name | 2,3,4,5-tetramethyl-6-[2-methylidene-1,1-bis(2H-triazol-4-yl)butyl]phenol |
|---|---|
| PubChem CID | 150398320 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2,3,4,5-tetramethyl-6-[2-methylidene-1,1-bis(2H-triazol-4-yl)butyl]phenol |
| SMILES | C=C(CC)C(c1cn[nH]n1)(c1cn[nH]n1)c1c(C)c(C)c(C)c(C)c1O |
| InChI | InChI=1S/C19H24N6O/c1-7-10(2)19(15-8-20-24-22-15,16-9-21-25-23-16)17-13(5)11(3)12(4)14(6)18(17)26/h8-9,26H,2,7H2,1,3-6H3,(H,20,22,24)(H,21,23,25) |
| InChIKey | HDFJUOJFVOVYBB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|