About benzo[e]azulen-10-ol
benzo[e]azulen-10-ol (PubChem CID 140974597) has the molecular formula C14H10O
and a molecular weight of 194.23 g/mol. Its IUPAC name is benzo[e]azulen-10-ol.
Molecular Properties
| Compound Name | benzo[e]azulen-10-ol |
| PubChem CID | 140974597 |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | benzo[e]azulen-10-ol |
| SMILES | Oc1cccc2cccc3cccc-3c12 |
| InChI | InChI=1S/C14H10O/c15-13-9-3-7-11-6-1-4-10-5-2-8-12(10)14(11)13/h1-9,15H |
| InChIKey | LVJKIUDFSSCYEH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzo[e]azulen-10-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[e]azulen-10-ol?
The IUPAC name of benzo[e]azulen-10-ol (CID 140974597) is benzo[e]azulen-10-ol.
What is the SMILES notation for benzo[e]azulen-10-ol?
The canonical SMILES for benzo[e]azulen-10-ol is Oc1cccc2cccc3cccc-3c12.
What is the InChIKey of benzo[e]azulen-10-ol?
The InChIKey is LVJKIUDFSSCYEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O/c15-13-9-3-7-11-6-1-4-10-5-2-8-12(10)14(11)13/h1-9,15H.
What are the key properties of benzo[e]azulen-10-ol?
benzo[e]azulen-10-ol has a molecular weight of 194.23 g/mol, XLogP of 3.65, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[e]azulen-10-ol is sourced from PubChem (CID 140974597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).