About butane;ethane;naphthalene-1,8-diol
butane;ethane;naphthalene-1,8-diol (PubChem CID 91186616) has the molecular formula C18H30O2
and a molecular weight of 278.44 g/mol. Its IUPAC name is butane;ethane;naphthalene-1,8-diol.
Molecular Properties
| Compound Name | butane;ethane;naphthalene-1,8-diol |
| PubChem CID | 91186616 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | butane;ethane;naphthalene-1,8-diol |
| SMILES | CC.CC.CCCC.Oc1cccc2cccc(O)c12 |
| InChI | InChI=1S/C10H8O2.C4H10.2C2H6/c11-8-5-1-3-7-4-2-6-9(12)10(7)8;1-3-4-2;2*1-2/h1-6,11-12H;3-4H2,1-2H3;2*1-2H3 |
| InChIKey | SKESTJKFZDCOLP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;ethane;naphthalene-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;naphthalene-1,8-diol?
The IUPAC name of butane;ethane;naphthalene-1,8-diol (CID 91186616) is butane;ethane;naphthalene-1,8-diol.
What is the SMILES notation for butane;ethane;naphthalene-1,8-diol?
The canonical SMILES for butane;ethane;naphthalene-1,8-diol is CC.CC.CCCC.Oc1cccc2cccc(O)c12.
What is the InChIKey of butane;ethane;naphthalene-1,8-diol?
The InChIKey is SKESTJKFZDCOLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.C4H10.2C2H6/c11-8-5-1-3-7-4-2-6-9(12)10(7)8;1-3-4-2;2*1-2/h1-6,11-12H;3-4H2,1-2H3;2*1-2H3.
What are the key properties of butane;ethane;naphthalene-1,8-diol?
butane;ethane;naphthalene-1,8-diol has a molecular weight of 278.44 g/mol, XLogP of 6.11, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;naphthalene-1,8-diol is sourced from PubChem (CID 91186616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).