C25H23N5OS2 — CID 140975574
2-[2-cyclohex-2-en-1-ylsulfanyl-5-(furan-2-yl)-3-(1H-pyrrol-2-yl)-4-thiophen-2-yl-3H-pyrazol-1-yl]pyrimidine (PubChem CID 140975574) has the molecular formula C25H23N5OS2 and a molecular weight of 473.63 g/mol. Its IUPAC name is 2-[2-cyclohex-2-en-1-ylsulfanyl-5-(furan-2-yl)-3-(1H-pyrrol-2-yl)-4-thiophen-2-yl-3H-pyrazol-1-yl]pyrimidine.
| Compound Name | 2-[2-cyclohex-2-en-1-ylsulfanyl-5-(furan-2-yl)-3-(1H-pyrrol-2-yl)-4-thiophen-2-yl-3H-pyrazol-1-yl]pyrimidine |
|---|---|
| PubChem CID | 140975574 |
| Molecular Formula | C25H23N5OS2 |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2-[2-cyclohex-2-en-1-ylsulfanyl-5-(furan-2-yl)-3-(1H-pyrrol-2-yl)-4-thiophen-2-yl-3H-pyrazol-1-yl]pyrimidine |
| SMILES | C1=CC(SN2C(c3ccc[nH]3)C(c3cccs3)=C(c3ccco3)N2c2ncccn2)CCC1 |
| InChI | InChI=1S/C25H23N5OS2/c1-2-8-18(9-3-1)33-30-23(19-10-4-13-26-19)22(21-12-6-17-32-21)24(20-11-5-16-31-20)29(30)25-27-14-7-15-28-25/h2,4-8,10-18,23,26H,1,3,9H2 |
| InChIKey | WOTDPTDKHLSNTL-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 61.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|