C27H42O4S2 — CID 14097582
3-[2-carboxyethylsulfanyl-[2-(8-cyclohexyloctyl)phenyl]methyl]sulfanylpropanoic acid (PubChem CID 14097582) has the molecular formula C27H42O4S2 and a molecular weight of 494.76 g/mol. Its IUPAC name is 3-[2-carboxyethylsulfanyl-[2-(8-cyclohexyloctyl)phenyl]methyl]sulfanylpropanoic acid.
| Compound Name | 3-[2-carboxyethylsulfanyl-[2-(8-cyclohexyloctyl)phenyl]methyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 14097582 |
| Molecular Formula | C27H42O4S2 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 3-[2-carboxyethylsulfanyl-[2-(8-cyclohexyloctyl)phenyl]methyl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCSC(SCCC(=O)O)c1ccccc1CCCCCCCCC1CCCCC1 |
| InChI | InChI=1S/C27H42O4S2/c28-25(29)18-20-32-27(33-21-19-26(30)31)24-17-11-10-16-23(24)15-9-4-2-1-3-6-12-22-13-7-5-8-14-22/h10-11,16-17,22,27H,1-9,12-15,18-21H2,(H,28,29)(H,30,31) |
| InChIKey | DDMDMDIPQGFBED-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|