About tert-butyl 2-butylbenzenesulfonate
tert-butyl 2-butylbenzenesulfonate (PubChem CID 140976068) has the molecular formula C14H22O3S
and a molecular weight of 270.39 g/mol. Its IUPAC name is tert-butyl 2-butylbenzenesulfonate.
Molecular Properties
| Compound Name | tert-butyl 2-butylbenzenesulfonate |
| PubChem CID | 140976068 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | tert-butyl 2-butylbenzenesulfonate |
| SMILES | CCCCc1ccccc1S(=O)(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22O3S/c1-5-6-9-12-10-7-8-11-13(12)18(15,16)17-14(2,3)4/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | HYITYBYIWBGCBV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-butylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-butylbenzenesulfonate?
The IUPAC name of tert-butyl 2-butylbenzenesulfonate (CID 140976068) is tert-butyl 2-butylbenzenesulfonate.
What is the SMILES notation for tert-butyl 2-butylbenzenesulfonate?
The canonical SMILES for tert-butyl 2-butylbenzenesulfonate is CCCCc1ccccc1S(=O)(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-butylbenzenesulfonate?
The InChIKey is HYITYBYIWBGCBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3S/c1-5-6-9-12-10-7-8-11-13(12)18(15,16)17-14(2,3)4/h7-8,10-11H,5-6,9H2,1-4H3.
What are the key properties of tert-butyl 2-butylbenzenesulfonate?
tert-butyl 2-butylbenzenesulfonate has a molecular weight of 270.39 g/mol, XLogP of 3.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-butylbenzenesulfonate is sourced from PubChem (CID 140976068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).