C21H26O6 — CID 140976423
(2S,3S,4S,5S,6R)-2-[[3-(3,5-dimethylphenyl)phenyl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 140976423) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-2-[[3-(3,5-dimethylphenyl)phenyl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5S,6R)-2-[[3-(3,5-dimethylphenyl)phenyl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 140976423 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (2S,3S,4S,5S,6R)-2-[[3-(3,5-dimethylphenyl)phenyl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1cc(C)cc(-c2cccc(CO[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)c2)c1 |
| InChI | InChI=1S/C21H26O6/c1-12-6-13(2)8-16(7-12)15-5-3-4-14(9-15)11-26-21-20(25)19(24)18(23)17(10-22)27-21/h3-9,17-25H,10-11H2,1-2H3/t17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | OXWUHJKCUGIJCT-MJCUULBUSA-N |
| XLogP | 1.29 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |