C16H16N2O5 — CID 140976820
2-[3-(4-pyrrol-1-ylphenyl)propanoylamino]propanedioic acid (PubChem CID 140976820) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-[3-(4-pyrrol-1-ylphenyl)propanoylamino]propanedioic acid.
| Compound Name | 2-[3-(4-pyrrol-1-ylphenyl)propanoylamino]propanedioic acid |
|---|---|
| PubChem CID | 140976820 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[3-(4-pyrrol-1-ylphenyl)propanoylamino]propanedioic acid |
| SMILES | O=C(CCc1ccc(-n2cccc2)cc1)NC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H16N2O5/c19-13(17-14(15(20)21)16(22)23)8-5-11-3-6-12(7-4-11)18-9-1-2-10-18/h1-4,6-7,9-10,14H,5,8H2,(H,17,19)(H,20,21)(H,22,23) |
| InChIKey | OXOQNUKCKBEBRS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|