C21H17NO3S2 — CID 140977661
2-phenyl-2-[[2-(phenyldisulfanyl)benzoyl]amino]acetic acid (PubChem CID 140977661) has the molecular formula C21H17NO3S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-phenyl-2-[[2-(phenyldisulfanyl)benzoyl]amino]acetic acid.
| Compound Name | 2-phenyl-2-[[2-(phenyldisulfanyl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 140977661 |
| Molecular Formula | C21H17NO3S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2-phenyl-2-[[2-(phenyldisulfanyl)benzoyl]amino]acetic acid |
| SMILES | O=C(NC(C(=O)O)c1ccccc1)c1ccccc1SSc1ccccc1 |
| InChI | InChI=1S/C21H17NO3S2/c23-20(22-19(21(24)25)15-9-3-1-4-10-15)17-13-7-8-14-18(17)27-26-16-11-5-2-6-12-16/h1-14,19H,(H,22,23)(H,24,25) |
| InChIKey | RWTQWCKBTDZZPW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|